Fmoc-DL-citrulline structure
|
Common Name | Fmoc-DL-citrulline | ||
|---|---|---|---|---|
| CAS Number | 161125-34-4 | Molecular Weight | 397.424 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 671.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C21H23N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 359.9±31.5 °C | |
| Name | Fmoc-DL-citrulline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 671.5±55.0 °C at 760 mmHg |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.424 |
| Flash Point | 359.9±31.5 °C |
| Exact Mass | 397.163757 |
| PSA | 130.75000 |
| LogP | 2.70 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | NBMSMZSRTIOFOK-UHFFFAOYSA-N |
| SMILES | NC(=O)NCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ornithine, N-(aminocarbonyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| Fmoc-D-iAsn |
| N-Carbamoyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]ornithine |