1,4-Naphthalenediol,2-methyl-, 1,4-bis(hydrogen sulfate), sodium salt (1:2) structure
|
Common Name | 1,4-Naphthalenediol,2-methyl-, 1,4-bis(hydrogen sulfate), sodium salt (1:2) | ||
|---|---|---|---|---|
| CAS Number | 1612-30-2 | Molecular Weight | 378.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8Na2O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | menadiol sodium sulfate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H8Na2O8S2 |
|---|---|
| Molecular Weight | 378.28600 |
| Exact Mass | 377.94600 |
| PSA | 149.62000 |
| LogP | 2.98780 |
| InChIKey | VIXBZWJMHHVLBT-UHFFFAOYSA-L |
| SMILES | Cc1cc(OS(=O)(=O)[O-])c2ccccc2c1OS(=O)(=O)[O-].[Na+].[Na+] |
| HS Code | 2922199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| menadiole sodium sulfate |
| 2-Methyl-1,4-bis-sulfooxy-naphthalin,Dinatrium-Salz |
| menadiole sodium sulphate |
| 2-methyl-1,4-bis-sulfooxy-naphthalene,disodium-salt |