3-benzyl-2-hydroxybenzoic acid structure
|
Common Name | 3-benzyl-2-hydroxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 16122-06-8 | Molecular Weight | 228.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-benzyl-2-hydroxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12O3 |
|---|---|
| Molecular Weight | 228.24300 |
| Exact Mass | 228.07900 |
| PSA | 57.53000 |
| LogP | 2.68120 |
| InChIKey | YUVVASYGZFERRP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(Cc2ccccc2)c1O |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 3-Benzyl-2-hydroxy-benzoesaeure |
| 3-benzyl-2-hydroxy-benzoic acid |