Methyl 8-methoxy-4-oxo-1,2,3,4-tetrahydro-2-naphthalenecarboxylat e
Modify Date: 2025-09-21 18:06:11
Methyl 8-methoxy-4-oxo-1,2,3,4-tetrahydro-2-naphthalenecarboxylat e structure
|
Common Name | Methyl 8-methoxy-4-oxo-1,2,3,4-tetrahydro-2-naphthalenecarboxylat e | ||
|---|---|---|---|---|
| CAS Number | 16122-45-5 | Molecular Weight | 234.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 8-methoxy-4-oxo-1,2,3,4-tetrahydro-2-naphthalenecarboxylat e |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14O4 |
|---|---|
| Molecular Weight | 234.24800 |
| Exact Mass | 234.08900 |
| PSA | 52.60000 |
| LogP | 1.61330 |
| InChIKey | CJPDNAVTSDDREB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(=O)c2cccc(OC)c2C1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-oxo-5-azaisochroman-4-spiro-2'-oxirane |