(S)-[(4S,5R,7R)-5-ETHENYL-1-AZABICYCLO[2.2.2]OCTAN-7-YL]-(6-METHOXYQUINOLIN-4-YL)METHANOLSULFATEDIHYDRATE structure
|
Common Name | (S)-[(4S,5R,7R)-5-ETHENYL-1-AZABICYCLO[2.2.2]OCTAN-7-YL]-(6-METHOXYQUINOLIN-4-YL)METHANOLSULFATEDIHYDRATE | ||
|---|---|---|---|---|
| CAS Number | 161229-01-2 | Molecular Weight | 248.14900 | |
| Density | 1.233g/cm3 | Boiling Point | 348.6ºC at 760mmHg | |
| Molecular Formula | C11H15Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.6ºC | |
| Name | (1S)-1-(3,4-dichlorophenyl)-3-(dimethylamino)propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 348.6ºC at 760mmHg |
| Molecular Formula | C11H15Cl2NO |
| Molecular Weight | 248.14900 |
| Flash Point | 164.6ºC |
| Exact Mass | 247.05300 |
| PSA | 23.47000 |
| LogP | 2.97850 |
| Vapour Pressure | 1.87E-05mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | MXOPILVGQYKXRO-NSHDSACASA-N |
| SMILES | CN(C)CCC(O)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenemethanol,3,4-dichloro-a-[2-(dimethylamino)ethyl]-,(aS) |
| (s)-1-(3,4-dichloro-phenyl)-3-dimethylamino-propan-1-ol |
| S01-0785 |