2-(6-ethoxy-1,3-benzothiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-octahydro-1H-4,7-epoxyisoindole-1,3-dione
Modify Date: 2025-08-25 22:16:44
2-(6-ethoxy-1,3-benzothiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-octahydro-1H-4,7-epoxyisoindole-1,3-dione structure
|
Common Name | 2-(6-ethoxy-1,3-benzothiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-octahydro-1H-4,7-epoxyisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 16131-62-7 | Molecular Weight | 344.38500 | |
| Density | 1.458g/cm3 | Boiling Point | 528.8ºC at 760 mmHg | |
| Molecular Formula | C17H16N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.6ºC | |
| Name | 2-(6-ethoxy-1,3-benzothiazol-2-yl)-3a,4,5,6,7,7a-hexahydro-octahydro-1H-4,7-epoxyisoindole-1,3-dione |
|---|
| Density | 1.458g/cm3 |
|---|---|
| Boiling Point | 528.8ºC at 760 mmHg |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.38500 |
| Flash Point | 273.6ºC |
| Exact Mass | 344.08300 |
| PSA | 96.97000 |
| LogP | 2.42680 |
| Vapour Pressure | 2.87E-11mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | QUNMFLKWYQTRDU-UHFFFAOYSA-N |
| SMILES | CCOc1ccc2nc(N3C(=O)C4C5CCC(O5)C4C3=O)sc2c1 |
|
~%
2-(6-ethoxy-1,3... CAS#:16131-62-7 |
| Literature: Rice,L.M. et al. Journal of Medicinal Chemistry, 1968 , vol. 11, # 1 p. 183 - 185 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |