ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate structure
|
Common Name | ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1613457-99-0 | Molecular Weight | 245.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15N3O2 |
|---|---|
| Molecular Weight | 245.28 |
| InChIKey | URIAZLCGSAMMFI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cn(CCc2ccccc2)nn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: Molecular weight of ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate is 245.28. |
| Q: What is the InChIKey of ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: InChIKey of ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate is URIAZLCGSAMMFI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: Molecular formula of ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate is C13H15N3O2. |
| Q: What is the CAS number of ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: CAS number of ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate is 1613457-99-0. |
| Q: What is the English name of ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: The English name of ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate is ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate. |
| Q: What is the Chinese name of 1613457-99-0? |
| A: Chinese name of 1613457-99-0 is 1613457-99-0. |
| Q: What is the SMILES notation of ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate? |
| A: SMILES notation of ethyl 1-(2-phenylethyl)-1H-1,2,3-triazole-4-carboxylate is CCOC(=O)c1cn(CCc2ccccc2)nn1. |