A 410099.1, amine-Boc
Modify Date: 2025-08-26 18:38:42
A 410099.1, amine-Boc structure
|
Common Name | A 410099.1, amine-Boc | ||
|---|---|---|---|---|
| CAS Number | 1613552-03-6 | Molecular Weight | 583.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H49N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of A 410099.1, amine-BocA 410099.1, amine-Bocis a functionalized IAP ligand and can be used for the synthesis of PROTACs, such as PROTACs targeting BTK (PROTACs 4 and 5)[1]. |
| Name | A 410099.1, amine-Boc |
|---|
| Description | A 410099.1, amine-Bocis a functionalized IAP ligand and can be used for the synthesis of PROTACs, such as PROTACs targeting BTK (PROTACs 4 and 5)[1]. |
|---|---|
| Related Catalog | |
| Target |
cIAP1 |
| References |
| Molecular Formula | C32H49N5O5 |
|---|---|
| Molecular Weight | 583.76 |
| InChIKey | MQXRDFRHLFKZNZ-JKGXFXTOSA-N |
| SMILES | CC(C(=O)NC(C(=O)N1CC(N)CC1C(=O)NC1CCCc2ccccc21)C1CCCCC1)N(C)C(=O)OC(C)(C)C |
| Storage condition | 2-8°C |