4-[5-(4-hydroxyphenoxy)pentoxy]phenol structure
|
Common Name | 4-[5-(4-hydroxyphenoxy)pentoxy]phenol | ||
|---|---|---|---|---|
| CAS Number | 16146-59-1 | Molecular Weight | 288.33800 | |
| Density | 1.178g/cm3 | Boiling Point | 497ºC at 760 mmHg | |
| Molecular Formula | C17H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.4ºC | |
| Name | 4-[5-(4-hydroxyphenoxy)pentoxy]phenol |
|---|
| Density | 1.178g/cm3 |
|---|---|
| Boiling Point | 497ºC at 760 mmHg |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.33800 |
| Flash Point | 254.4ºC |
| Exact Mass | 288.13600 |
| PSA | 58.92000 |
| LogP | 3.72590 |
| Vapour Pressure | 1.68E-10mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | CVFFLNSOIOGOFJ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(OCCCCCOc2ccc(O)cc2)cc1 |
| HS Code | 2909500000 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |