DHOG structure
|
Common Name | DHOG | ||
|---|---|---|---|---|
| CAS Number | 161466-45-1 | Molecular Weight | 1518.48000 | |
| Density | 1.747g/cm3 | Boiling Point | 993.5ºC at 760mmHg | |
| Molecular Formula | C47H68I6N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 554.6ºC | |
Use of DHOGDHOG is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 1,3-bis[7-(3-amino-2,4,6-triiodophenyl)heptanoyloxy]propan-2-yl (Z)-octadec-9-enoate |
|---|---|
| Synonym | More Synonyms |
| Description | DHOG is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.747g/cm3 |
|---|---|
| Boiling Point | 993.5ºC at 760mmHg |
| Molecular Formula | C47H68I6N2O6 |
| Molecular Weight | 1518.48000 |
| Flash Point | 554.6ºC |
| Exact Mass | 1517.93000 |
| PSA | 130.94000 |
| LogP | 16.36290 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | WPURVAFCMUEHIC-KTKRTIGZSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCc1c(I)cc(I)c(N)c1I)COC(=O)CCCCCCc1c(I)cc(I)c(N)c1I |
| Benzeneheptanoic acid,3-amino-2,4,6-triiodo-,2-(((9Z)-1-oxo-9-octadecenyl)oxy)-1,3-propanediyl ester |
| Benzeneheptanoic acid,3-amino-2,4,6-triiodo-,2-((1-oxo-9-octadecenyl)oxy)-1,3-propanediyl ester,(Z) |
| DHOG |