1H-Imidazole,1-methyl-2-(methylsulfonyl)-5-nitro- structure
|
Common Name | 1H-Imidazole,1-methyl-2-(methylsulfonyl)-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 1615-53-8 | Molecular Weight | 205.19200 | |
| Density | 1.65g/cm3 | Boiling Point | 424.8ºC at 760mmHg | |
| Molecular Formula | C5H7N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.7ºC | |
| Name | 1-methyl-2-methylsulfonyl-5-nitroimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 424.8ºC at 760mmHg |
| Molecular Formula | C5H7N3O4S |
| Molecular Weight | 205.19200 |
| Flash Point | 210.7ºC |
| Exact Mass | 205.01600 |
| PSA | 106.16000 |
| LogP | 1.33580 |
| Vapour Pressure | 2E-07mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | RSOPCRYPVDDVAX-UHFFFAOYSA-N |
| SMILES | Cn1c([N+](=O)[O-])cnc1S(C)(=O)=O |
| HS Code | 2933290090 |
|---|
|
~87%
1H-Imidazole,1-... CAS#:1615-53-8 |
| Literature: Chauviere, Gerard; Bouteille, Bernard; Enanga, Bertin; De Albuquerque, Cristina; Croft, Simon L.; Dumas, Michel; Perie, Jacques Journal of Medicinal Chemistry, 2003 , vol. 46, # 3 p. 427 - 440 |
|
~%
1H-Imidazole,1-... CAS#:1615-53-8 |
| Literature: Chauviere, Gerard; Bouteille, Bernard; Enanga, Bertin; De Albuquerque, Cristina; Croft, Simon L.; Dumas, Michel; Perie, Jacques Journal of Medicinal Chemistry, 2003 , vol. 46, # 3 p. 427 - 440 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-methanesulfonyl-1-methyl-5-nitro-1H-imidazole |
| 1-methyl-2-methylsulphonyl-5-nitroimidazole |
| 1-methyl-2-methanesulphonyl-5-nitroimidazole |
| 1-Methyl-2-methylsulfonyl-5-nitro-imidazol |
| Sulfonidazole |
| 1-methyl-2-(methylsulfonyl)-5-nitro-1h-imidazole |
| 1H-Imidazole,1-methyl-2-(methylsulfonyl)-5-nitro |
| 2-methanesulphonyl-1-methyl-5-nitroimidazole |