Oxazole,2-(4-methylphenyl)-5-phenyl structure
|
Common Name | Oxazole,2-(4-methylphenyl)-5-phenyl | ||
|---|---|---|---|---|
| CAS Number | 16155-60-5 | Molecular Weight | 235.28100 | |
| Density | 1.108g/cm3 | Boiling Point | 396.4ºC at 760mmHg | |
| Molecular Formula | C16H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.7ºC | |
| Name | 2-(4-methylphenyl)-5-phenyl-1,3-oxazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.108g/cm3 |
|---|---|
| Boiling Point | 396.4ºC at 760mmHg |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.28100 |
| Flash Point | 166.7ºC |
| Exact Mass | 235.10000 |
| PSA | 26.03000 |
| LogP | 4.31700 |
| Vapour Pressure | 3.93E-06mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | LTGNYHGEFNFIBD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2ncc(-c3ccccc3)o2)cc1 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
|
Name: A screen for compounds that inhibit the activity of LtaS in Staphylococcus aureus
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
External Id: HMS979
|
|
Name: A screen for compounds that inhibit viral RNA polymerase binding and polymerization a...
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: Chain A, Poliovirus Polymerase With Gtp
External Id: HMS750
|
| oxazole,2-(4-methylphenyl)-5-phenyl |
| HMS1399N01 |
| 2-(4-methylphenyl)-5-phenyloxazole |
| 5-Phenyl-2-(p-tolyl)oxazol |
| 5-phenyl-2-p-tolyl-oxazole |