N-Methyl-4-(4-piperidinyl)benzamide structure
|
Common Name | N-Methyl-4-(4-piperidinyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 161610-09-9 | Molecular Weight | 218.295 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 399.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H18N2O | Melting Point | N/A | |
| MSDS | USA | Flash Point | 160.6±28.0 °C | |
| Name | N-methyl-4-piperidin-4-ylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 399.8±42.0 °C at 760 mmHg |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.295 |
| Flash Point | 160.6±28.0 °C |
| Exact Mass | 218.141907 |
| PSA | 41.13000 |
| LogP | 1.03 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | MDCWPUNPTDQWBD-UHFFFAOYSA-N |
| SMILES | CNC(=O)c1ccc(C2CCNCC2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzamide, N-methyl-4-(4-piperidinyl)- |
| N-Methyl-4-piperidin-4-yl-benzamide |
| N-Methyl-4-(Piperidin-4-Yl)Benzamide |
| N-Methyl-4-(4-piperidinyl)benzamide |