2-Methyl-2-(nitrooxy)propanoic acid structure
|
Common Name | 2-Methyl-2-(nitrooxy)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1617-35-2 | Molecular Weight | 149.10200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Methyl-2-(nitrooxy)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4H7NO5 |
|---|---|
| Molecular Weight | 149.10200 |
| Exact Mass | 149.03200 |
| PSA | 92.35000 |
| LogP | 0.58110 |
| InChIKey | MSBKTJKUKRRTOZ-UHFFFAOYSA-N |
| SMILES | CC(C)(O[N+](=O)[O-])C(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Nitryloxy-isobuttersaeure |
| 2-nitrooxyethyl acetoacetate |
| 2-methyl-2-nitroxypropionic acid |
| 2-nitroxyethyl acetoacetate |
| 2-nitrooxyisobutyric acid |