Benzenesulfonic acid, 4-amino-, compd. with 1-[ (2-diethylamino)ethyl]amino]-4-methylthioxanthen-9-one (1:1) structure
|
Common Name | Benzenesulfonic acid, 4-amino-, compd. with 1-[ (2-diethylamino)ethyl]amino]-4-methylthioxanthen-9-one (1:1) | ||
|---|---|---|---|---|
| CAS Number | 16170-85-7 | Molecular Weight | 513.67200 | |
| Density | N/A | Boiling Point | 512.4ºC at 760 mmHg | |
| Molecular Formula | C26H31N3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.7ºC | |
| Name | 4-aminobenzenesulfonic acid,1-[2-(diethylamino)ethylamino]-4-methylthioxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 512.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C26H31N3O4S2 |
| Molecular Weight | 513.67200 |
| Flash Point | 263.7ºC |
| Exact Mass | 513.17600 |
| PSA | 149.35000 |
| LogP | 6.72730 |
| Vapour Pressure | 1.3E-10mmHg at 25°C |
| InChIKey | OTWYAXNLCLWOGD-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNc1ccc(C)c2sc3ccccc3c(=O)c12.Nc1ccc(S(=O)(=O)O)cc1 |
| 4-aminobenzenesulfonic acid-1-{[2-(diethylamino)ethyl]amino}-4-methyl-9h-thioxanthen-9-one(1:1) |
| Thioxanthen-9-one,monosulfanilate |
| Leucanthone,p-aminobenzenesulfonate |