Potassium;trifluoro(oxolan-3-ylmethyl)boranuide
Modify Date: 2026-09-27 18:38:49
Potassium;trifluoro(oxolan-3-ylmethyl)boranuide structure
|
Common Name | Potassium;trifluoro(oxolan-3-ylmethyl)boranuide | ||
|---|---|---|---|---|
| CAS Number | 1617543-86-8 | Molecular Weight | 192.03 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H9BF3KO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Potassium;trifluoro(oxolan-3-ylmethyl)boranuide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H9BF3KO |
|---|---|
| Molecular Weight | 192.03 |
| InChIKey | LTJFIUMXCLWVDJ-UHFFFAOYSA-N |
| SMILES | F[B-](F)(F)CC1CCOC1.[K+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Potassium;trifluoro(oxolan-3-ylmethyl)boranuide? |
| A: Molecular weight of Potassium;trifluoro(oxolan-3-ylmethyl)boranuide is 192.03. |
| Q: What is the SMILES notation of Potassium;trifluoro(oxolan-3-ylmethyl)boranuide? |
| A: SMILES notation of Potassium;trifluoro(oxolan-3-ylmethyl)boranuide is F[B-](F)(F)CC1CCOC1.[K+]. |
| Q: What is the molecular formula of Potassium;trifluoro(oxolan-3-ylmethyl)boranuide? |
| A: Molecular formula of Potassium;trifluoro(oxolan-3-ylmethyl)boranuide is C5H9BF3KO. |
| Q: What is the Chinese name of 1617543-86-8? |
| A: Chinese name of 1617543-86-8 is 1617543-86-8. |
| Q: What is the InChIKey of Potassium;trifluoro(oxolan-3-ylmethyl)boranuide? |
| A: InChIKey of Potassium;trifluoro(oxolan-3-ylmethyl)boranuide is LTJFIUMXCLWVDJ-UHFFFAOYSA-N. |
| Q: What is the English name of Potassium;trifluoro(oxolan-3-ylmethyl)boranuide? |
| A: The English name of Potassium;trifluoro(oxolan-3-ylmethyl)boranuide is Potassium;trifluoro(oxolan-3-ylmethyl)boranuide. |
| Q: What is the CAS number of Potassium;trifluoro(oxolan-3-ylmethyl)boranuide? |
| A: CAS number of Potassium;trifluoro(oxolan-3-ylmethyl)boranuide is 1617543-86-8. |