Ethanone,1-(3-nitro-4-pyridinyl)- structure
|
Common Name | Ethanone,1-(3-nitro-4-pyridinyl)- | ||
|---|---|---|---|---|
| CAS Number | 161871-65-4 | Molecular Weight | 166.13400 | |
| Density | 1.318g/cm3 | Boiling Point | 309.8ºC at 760mmHg | |
| Molecular Formula | C7H6N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.2ºC | |
| Name | 1-(3-nitropyridin-4-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 309.8ºC at 760mmHg |
| Molecular Formula | C7H6N2O3 |
| Molecular Weight | 166.13400 |
| Flash Point | 141.2ºC |
| Exact Mass | 166.03800 |
| PSA | 75.78000 |
| LogP | 1.71560 |
| Vapour Pressure | 0.000623mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | WJBPEUKZXRFJDM-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccncc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~82%
Ethanone,1-(3-n... CAS#:161871-65-4 |
| Literature: Morgentin, Remy; Pasquet, Georges; Boutron, Pascal; Jung, Frederic; Lamorlette, Maryannick; Maudet, Mickael; Ple, Patrick Tetrahedron, 2008 , vol. 64, # 12 p. 2772 - 2782 |
|
~%
Ethanone,1-(3-n... CAS#:161871-65-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 38, # 7 p. 1106 - 1118 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-acetyl-5-nitropyridine |
| 4-Acetyl-3-nitropyridine |
| TPC-PY013 |