Piperazine,1-methyl-4-[2-[(4-methylphenyl)sulfonyl]ethyl]- structure
|
Common Name | Piperazine,1-methyl-4-[2-[(4-methylphenyl)sulfonyl]ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 16191-68-7 | Molecular Weight | 282.40200 | |
| Density | 1.136g/cm3 | Boiling Point | 450.9ºC at 760mmHg | |
| Molecular Formula | C14H22N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.5ºC | |
| Name | 1-methyl-4-[2-(4-methylphenyl)sulfonylethyl]piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.136g/cm3 |
|---|---|
| Boiling Point | 450.9ºC at 760mmHg |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.40200 |
| Flash Point | 226.5ºC |
| Exact Mass | 282.14000 |
| PSA | 49.00000 |
| LogP | 1.97270 |
| Vapour Pressure | 2.53E-08mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | MMXGWBCIPHBJHP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CCN2CCN(C)CC2)cc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Methylphenyl-2-(4-methyl-1-piperazinyl)-ethyl-sulfon |
| N-<2-(4-Methyl-phenylsulfonyl)-ethyl>-N'-methyl-piperazin |
| 1-methyl-4-{2-[(4-methylphenyl)sulfonyl]ethyl}piperazine |
| 1-methyl-4-[2-(toluene-4-sulfonyl)-ethyl]-piperazine |
| Piperazine,1-methyl-4-[2-(p-tolylsulfonyl)ethyl] |