3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)]
Modify Date: 2026-07-28 17:03:12
![3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)] Structure](https://www.chemsrc.com/extcaspic/324/161970-73-6.png)
3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)] structure
|
Common Name | 3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)] | ||
|---|---|---|---|---|
| CAS Number | 161970-73-6 | Molecular Weight | 218.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10O4 |
|---|---|
| Molecular Weight | 218.20 |
| InChIKey | MGLLNHBEFIYBME-AUTRQRHGSA-N |
| SMILES | O=C(O)C12CC1C(c1ccccc1)OC2=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)]? |
| A: SMILES notation of 3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)] is O=C(O)C12CC1C(c1ccccc1)OC2=O. |
| Q: What is the InChIKey of 3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)]? |
| A: InChIKey of 3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)] is MGLLNHBEFIYBME-AUTRQRHGSA-N. |
| Q: What is the CAS number of 3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)]? |
| A: CAS number of 3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)] is 161970-73-6. |
| Q: What is the English name of 3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)]? |
| A: The English name of 3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)] is 3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)]. |
| Q: What is the molecular formula of 3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)]? |
| A: Molecular formula of 3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)] is C12H10O4. |
| Q: What is the Chinese name of 161970-73-6? |
| A: Chinese name of 161970-73-6 is 161970-73-6. |
| Q: What is the molecular weight of 3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)]? |
| A: Molecular weight of 3-Oxabicyclo[3.1.0]hexane-1-carboxylic acid, 2-oxo-4-phenyl-, [1S-(1I+/-,4I+/-,5I+/-)] is 218.20. |