ethyl 2-[[2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]-3-(4-hydroxyphenyl)propanoate structure
|
Common Name | ethyl 2-[[2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]-3-(4-hydroxyphenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 1620-24-2 | Molecular Weight | 538.46300 | |
| Density | 1.272g/cm3 | Boiling Point | 796.9ºC at 760 mmHg | |
| Molecular Formula | C26H33Cl2N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 435.8ºC | |
| Name | ethyl 2-[[2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 796.9ºC at 760 mmHg |
| Molecular Formula | C26H33Cl2N3O5 |
| Molecular Weight | 538.46300 |
| Flash Point | 435.8ºC |
| Exact Mass | 537.18000 |
| PSA | 114.95000 |
| LogP | 4.69460 |
| Vapour Pressure | 2.16E-26mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | SULYQGVAYSECAW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccc(O)cc1)NC(=O)C(Cc1ccc(N(CCCl)CCCl)cc1)NC(C)=O |
| ethylester of N-acetylsarcolysyltyronine |
| Astyron |
| L-Tyrosine,N-(N-acetyl-4-(bis(2-chloroethyl)amino)-DL-phenylalanyl)-,ethyl ester |
| Astiron |
| N-Acetyl-p-(bis(2-chloroethyl)amino)phenylalanyl-tyrosine ethyl ester |