2,6-Bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol structure
|
Common Name | 2,6-Bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol | ||
|---|---|---|---|---|
| CAS Number | 1620-68-4 | Molecular Weight | 348.43500 | |
| Density | 1.191g/cm3 | Boiling Point | 533.7ºC at 760mmHg | |
| Molecular Formula | C23H24O3 | Melting Point | 214ºC | |
| MSDS | N/A | Flash Point | 241.9C | |
| Name | 2,6-Bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.191g/cm3 |
|---|---|
| Boiling Point | 533.7ºC at 760mmHg |
| Melting Point | 214ºC |
| Molecular Formula | C23H24O3 |
| Molecular Weight | 348.43500 |
| Flash Point | 241.9C |
| Exact Mass | 348.17300 |
| PSA | 60.69000 |
| LogP | 4.91020 |
| Vapour Pressure | 5.28E-12mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | MAQOZOILPAMFSW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(Cc2cc(C)cc(Cc3cc(C)ccc3O)c2O)c1 |
| HS Code | 2907299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| EINECS 216-587-3 |
| 2,5,6-TRIMETHYL-3-OXO-2,3-DIHYDROPYRIDAZINE-4-CARBOXYLIC ACID |
| 2,2'-((2-Hydroxy-5-methyl-1,3-phenylene)bis(methylene))bis(4-methylphenol) |
| 2,6-Bis(p-cresol-2-ylmethyl)-p-cresol |