Trametinib metabolite M4
Modify Date: 2025-08-23 17:58:31
Trametinib metabolite M4 structure
|
Common Name | Trametinib metabolite M4 | ||
|---|---|---|---|---|
| CAS Number | 1620017-28-8 | Molecular Weight | 765.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H29FIN5O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Trametinib metabolite M4 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C30H29FIN5O10 |
|---|---|
| Molecular Weight | 765.5 |
| InChIKey | IGXOTSIHRCCVJX-ZHOCNHIISA-N |
| SMILES | Cc1c(=O)n(C)c(Nc2ccc(I)cc2F)c2c(=O)n(C3CC3)c(=O)n(-c3ccc(OC4OC(C(=O)O)C(O)C(O)C4O)c(N)c3)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Trametinib metabolite M4? |
| A: Molecular formula of Trametinib metabolite M4 is C30H29FIN5O10. |
| Q: What is the CAS number of Trametinib metabolite M4? |
| A: CAS number of Trametinib metabolite M4 is 1620017-28-8. |
| Q: What is the Chinese name of 1620017-28-8? |
| A: Chinese name of 1620017-28-8 is 1620017-28-8. |
| Q: What is the InChIKey of Trametinib metabolite M4? |
| A: InChIKey of Trametinib metabolite M4 is IGXOTSIHRCCVJX-ZHOCNHIISA-N. |
| Q: What is the molecular weight of Trametinib metabolite M4? |
| A: Molecular weight of Trametinib metabolite M4 is 765.5. |
| Q: What is the SMILES notation of Trametinib metabolite M4? |
| A: SMILES notation of Trametinib metabolite M4 is Cc1c(=O)n(C)c(Nc2ccc(I)cc2F)c2c(=O)n(C3CC3)c(=O)n(-c3ccc(OC4OC(C(=O)O)C(O)C(O)C4O)c(N)c3)c12. |
| Q: What is the English name of Trametinib metabolite M4? |
| A: The English name of Trametinib metabolite M4 is Trametinib metabolite M4. |