Boc-D-Lys(N3)-OH structure
|
Common Name | Boc-D-Lys(N3)-OH | ||
|---|---|---|---|---|
| CAS Number | 1620410-04-9 | Molecular Weight | 272.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Boc-D-Lys(N3)-OHBoc-D-Lys(N3)-OH is a Boc-protected amino acid derivative, can be used as a click chemistry reagent and an intermediate for synthesis of linkers[1]. |
| Name | Boc-D-Lys(N3)-OH |
|---|
| Description | Boc-D-Lys(N3)-OH is a Boc-protected amino acid derivative, can be used as a click chemistry reagent and an intermediate for synthesis of linkers[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Sandrine Gerber, et al. Compounds for functionalizing biomaterials. WO2014111545 |
| Molecular Formula | C11H20N4O4 |
|---|---|
| Molecular Weight | 272.30 |
| InChIKey | SKRPDWWWUARZIW-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCCCN=[N+]=[N-])C(=O)O |