(2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate
Modify Date: 2025-11-07 21:48:53
(2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate structure
|
Common Name | (2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate | ||
|---|---|---|---|---|
| CAS Number | 1620522-33-9 | Molecular Weight | 359.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12BrFO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12BrFO3S |
|---|---|
| Molecular Weight | 359.21 |
| InChIKey | YQCPYGOOHMOTHH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCc2cc(F)ccc2Br)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate? |
| A: The English name of (2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate is (2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate. |
| Q: What is the SMILES notation of (2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate? |
| A: SMILES notation of (2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate is Cc1ccc(S(=O)(=O)OCc2cc(F)ccc2Br)cc1. |
| Q: What is the Chinese name of 1620522-33-9? |
| A: Chinese name of 1620522-33-9 is 1620522-33-9. |
| Q: What is the molecular weight of (2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate? |
| A: Molecular weight of (2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate is 359.21. |
| Q: What is the InChIKey of (2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate? |
| A: InChIKey of (2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate is YQCPYGOOHMOTHH-UHFFFAOYSA-N. |
| Q: What is the CAS number of (2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate? |
| A: CAS number of (2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate is 1620522-33-9. |
| Q: What is the molecular formula of (2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate? |
| A: Molecular formula of (2-Bromo-5-fluorophenyl)methyl 4-methylbenzene-1-sulfonate is C14H12BrFO3S. |