ethyl 1-[(4-methylphenyl)methyl]cyclopropane-1-carboxylate structure
|
Common Name | ethyl 1-[(4-methylphenyl)methyl]cyclopropane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1621-32-5 | Molecular Weight | 218.29200 | |
| Density | 1.089g/cm3 | Boiling Point | 294.1ºC at 760mmHg | |
| Molecular Formula | C14H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.1ºC | |
| Name | ethyl 1-[(4-methylphenyl)methyl]cyclopropane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.089g/cm3 |
|---|---|
| Boiling Point | 294.1ºC at 760mmHg |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.29200 |
| Flash Point | 124.1ºC |
| Exact Mass | 218.13100 |
| PSA | 26.30000 |
| LogP | 2.88080 |
| Vapour Pressure | 0.00166mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | CMPPICYVULJWRY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(Cc2ccc(C)cc2)CC1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Ethyl 1-(p-methylbenzyl)cyclopropanecarboxylate |
| EINECS 216-593-6 |
| ethyl 1-(4-methylbenzyl)cyclopropanecarboxylate |