2-[(4-fluorophenyl)methylidene]indene-1,3-dione structure
|
Common Name | 2-[(4-fluorophenyl)methylidene]indene-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 16210-64-3 | Molecular Weight | 252.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H9FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(4-fluorophenyl)methylidene]indene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H9FO2 |
|---|---|
| Molecular Weight | 252.24000 |
| Exact Mass | 252.05900 |
| PSA | 34.14000 |
| LogP | 3.28830 |
| InChIKey | MBHDCJLDOHEKIU-UHFFFAOYSA-N |
| SMILES | O=C1C(=Cc2ccc(F)cc2)C(=O)c2ccccc21 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-(4-fluorophenylmethylene)-1H-indane-1,3-dione |
| 2-(4-Fluorphenyliden)-1,3-indandion |
| 2-(4-fluorophenyl)methyleneindane-1,3-dione |
| MBHDCJLDOHEKIU-UHFFFAOYSA |
| 2-[(4-fluorophenyl)methylene]cyclopenta[1,2-a]benzene-1,3-dione |
| 1H-Indene-1,3(2H)-dione,2-[(4-fluorophenyl)methylene] |