Methyl 6-chloro-1H-indole-5-carboxylate structure
|
Common Name | Methyl 6-chloro-1H-indole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 162100-83-6 | Molecular Weight | 209.629 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 365.6±22.0 °C at 760 mmHg | |
| Molecular Formula | C10H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.9±22.3 °C | |
| Name | Methyl 6-chloro-1H-indole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 365.6±22.0 °C at 760 mmHg |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.629 |
| Flash Point | 174.9±22.3 °C |
| Exact Mass | 209.024353 |
| PSA | 42.09000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | IGOUVTSYCXABHI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2cc[nH]c2cc1Cl |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-5-carboxylic acid, 6-chloro-, methyl ester |
| Methyl 6-chloro-1H-indole-5-carboxylate |
| methyl 6-chloro-5-indolecarboxylate |
| 6-chloro-5-methoxycarbonyl indole |
| 6-Chloro-1H-indole-5-carboxylic acid methyl ester |