2-Fluoro-6-(2-morpholinothiazol-4-yl)phenol
Modify Date: 2025-09-12 09:29:23
2-Fluoro-6-(2-morpholinothiazol-4-yl)phenol structure
|
Common Name | 2-Fluoro-6-(2-morpholinothiazol-4-yl)phenol | ||
|---|---|---|---|---|
| CAS Number | 1621375-36-7 | Molecular Weight | 280.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13FN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Fluoro-6-(2-morpholinothiazol-4-yl)phenol |
|---|
| Molecular Formula | C13H13FN2O2S |
|---|---|
| Molecular Weight | 280.32 |
| InChIKey | PAYWHKLIJILMJY-UHFFFAOYSA-N |
| SMILES | Oc1c(F)cccc1-c1csc(N2CCOCC2)n1 |
|
Name: Inhibition of androgen receptor transcriptional activity in human LNCaP cells after 3...
Source: ChEMBL
Target: Androgen receptor
External Id: CHEMBL3374323
|
|
Name: Inhibition of androgen receptor in human LNCaP cells assessed as inhibition of prosta...
Source: ChEMBL
Target: Androgen receptor
External Id: CHEMBL3374324
|
Total 2, Current Page 1 of 1
1