Tigolaner structure
|
Common Name | Tigolaner | ||
|---|---|---|---|---|
| CAS Number | 1621436-41-6 | Molecular Weight | 552.81 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H13ClF8N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TigolanerTigolaner is a GABA antagonist that regulates chloride channel. Tigolaner is an antiparasitic agent[1]. |
| Name | Tigolaner |
|---|
| Description | Tigolaner is a GABA antagonist that regulates chloride channel. Tigolaner is an antiparasitic agent[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H13ClF8N6O |
|---|---|
| Molecular Weight | 552.81 |
| InChIKey | TVAJZOVLQZNNCJ-UHFFFAOYSA-N |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1-n1cc(-c2ccc(Cl)c(C(=O)NC3(C#N)CC3)c2)cn1 |