1,3,4-Oxadiazol-2(3H)-one,5-(2-phenyl-4-quinolinyl)- structure
|
Common Name | 1,3,4-Oxadiazol-2(3H)-one,5-(2-phenyl-4-quinolinyl)- | ||
|---|---|---|---|---|
| CAS Number | 16219-60-6 | Molecular Weight | 289.28800 | |
| Density | 1.37g/cm3 | Boiling Point | 573ºC at 760mmHg | |
| Molecular Formula | C17H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2-phenylquinolin-4-yl)-3H-1,3,4-oxadiazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 573ºC at 760mmHg |
| Molecular Formula | C17H11N3O2 |
| Molecular Weight | 289.28800 |
| Exact Mass | 289.08500 |
| PSA | 71.78000 |
| LogP | 3.24510 |
| Vapour Pressure | 9.86E-14mmHg at 25°C |
| Index of Refraction | 1.709 |
| InChIKey | FJWSRZRCDLGEQW-UHFFFAOYSA-N |
| SMILES | O=c1[nH]nc(-c2cc(-c3ccccc3)nc3ccccc23)o1 |
|
~%
1,3,4-Oxadiazol... CAS#:16219-60-6 |
| Literature: Caldwell et al. Journal of the American Pharmaceutical Association (1912-1977), 1958 , vol. 47, p. 799,801, 802 |
|
~%
1,3,4-Oxadiazol... CAS#:16219-60-6 |
| Literature: Movrin Arzneimittel-Forschung, 1966 , vol. 16, # 11 p. 1572 - 1574 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-(2-phenyl-[4]quinolyl)-3H-[1,3,4]oxadiazol-2-one |
| 5-(2-phenylquinolin-4-yl)-1,3,4-oxadiazol-2-ol |
| 5-(2-phenyl-quinolin-4-yl)-3H-[1,3,4]oxadiazol-2-one |
| 5-(2-Phenyl-[4]chinolyl)-3H-[1,3,4]oxadiazol-2-on |