1,2,4-Methenopentalene-5,6-dicarboxylic acid, 1,2,3,3a,4,6a-hexahydro-, dimethyl ester structure
|
Common Name | 1,2,4-Methenopentalene-5,6-dicarboxylic acid, 1,2,3,3a,4,6a-hexahydro-, dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 16219-84-4 | Molecular Weight | 234.24800 | |
| Density | 1.4g/cm3 | Boiling Point | 318.8ºC at 760 mmHg | |
| Molecular Formula | C13H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.6ºC | |
| Name | Tetracyclo<4,3,0,04,9,O5,7>non-2-en-2,3-dicarbonsaeure-dimethylester |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 318.8ºC at 760 mmHg |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.24800 |
| Flash Point | 157.6ºC |
| Exact Mass | 234.08900 |
| PSA | 52.60000 |
| LogP | 0.77070 |
| Vapour Pressure | 0.000352mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | YZQAUJSISPRMIU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=O)OC)C2C3CC4C(C13)C42 |
|
~71%
1,2,4-Methenope... CAS#:16219-84-4 |
| Literature: Forman, Mark A.; Moran, Caitlin; Herres, Joseph P.; Stairs, Jason; Chopko, Emily; Pozzessere, Anthony; Kerrigan, Michael; Kelly, Carisa; Lowchyj, Lisa; Salandria, Kerry; Gallo, Annemarie; Loutzenhiser, Elizabeth Journal of Organic Chemistry, 2007 , vol. 72, # 8 p. 2996 - 3005 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |