Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine
Modify Date: 2025-09-09 22:42:08
![Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine Structure](https://www.chemsrc.com/extcaspic/333/1621906-60-2.png)
Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine structure
|
Common Name | Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine | ||
|---|---|---|---|---|
| CAS Number | 1621906-60-2 | Molecular Weight | 345.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20NO2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H20NO2PS |
|---|---|
| Molecular Weight | 345.4 |
| InChIKey | BWXYDSDVFPJTFY-YHEJKZAPSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3CC2CP3c2ccccc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine? |
| A: SMILES notation of Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine is Cc1ccc(S(=O)(=O)N2CC3CC2CP3c2ccccc2)cc1. |
| Q: What is the Chinese name of 1621906-60-2? |
| A: Chinese name of 1621906-60-2 is 1621906-60-2. |
| Q: What is the InChIKey of Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine? |
| A: InChIKey of Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine is BWXYDSDVFPJTFY-YHEJKZAPSA-N. |
| Q: What is the molecular formula of Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine? |
| A: Molecular formula of Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine is C18H20NO2PS. |
| Q: What is the CAS number of Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine? |
| A: CAS number of Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine is 1621906-60-2. |
| Q: What is the molecular weight of Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine? |
| A: Molecular weight of Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine is 345.4. |
| Q: What is the English name of Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine? |
| A: The English name of Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine is Exo-Phenyl Kwon [2.2.1] Bicyclic Phosphine. |