4-Carboxy-3-hydroxy-L-phenylalanine structure
|
Common Name | 4-Carboxy-3-hydroxy-L-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 16220-83-0 | Molecular Weight | 225.19800 | |
| Density | 1.517g/cm3 | Boiling Point | 477.7ºC at 760 mmHg | |
| Molecular Formula | C10H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.7ºC | |
| Name | 4-Carboxy-3-hydroxy-L-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.517g/cm3 |
|---|---|
| Boiling Point | 477.7ºC at 760 mmHg |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.19800 |
| Flash Point | 242.7ºC |
| Exact Mass | 225.06400 |
| PSA | 120.85000 |
| LogP | 0.74510 |
| Vapour Pressure | 6.23E-10mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | LLYAFACVUYLLLQ-ZETCQYMHSA-N |
| SMILES | NC(Cc1ccc(C(=O)O)c(O)c1)C(=O)O |
|
~%
4-Carboxy-3-hyd... CAS#:16220-83-0 |
| Literature: Leonard,F. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 478 - 481 |
| DL-4-Carboxy-m-tyrosine |