Pallidol structure
|
Common Name | Pallidol | ||
|---|---|---|---|---|
| CAS Number | 1622292-61-8 | Molecular Weight | 454.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PallidolPallidol is a potent and selective singlet oxygen quencher. Pallidol shows antioxidant and antifungal activities[1][2]. |
| Name | Pallidol |
|---|
| Description | Pallidol is a potent and selective singlet oxygen quencher. Pallidol shows antioxidant and antifungal activities[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C28H22O6 |
|---|---|
| Molecular Weight | 454.47 |
| InChIKey | YNVJOQCPHWKWSO-ZBVBGGFBSA-N |
| SMILES | Oc1ccc(C2c3c(O)cc(O)cc3C3C(c4ccc(O)cc4)c4c(O)cc(O)cc4C23)cc1 |