F992
Modify Date: 2024-01-29 13:52:57
F992 structure
|
Common Name | F992 | ||
|---|---|---|---|---|
| CAS Number | 162277-99-8 | Molecular Weight | 1028.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C45H65N13O11S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of F992F992 is an antidiuretic peptide and vasopressin (antidiuretic hormone) analogue[1]. |
| Name | F992 |
|---|
| Description | F992 is an antidiuretic peptide and vasopressin (antidiuretic hormone) analogue[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C45H65N13O11S2 |
|---|---|
| Molecular Weight | 1028.21 |
| InChIKey | QWIZXUKSCAJBBY-NDJSDKDCSA-N |
| SMILES | CCC1(C)NC(=O)C(Cc2cccs2)NC(=O)C(Cc2ccccc2)NC(=O)CCCSCC(C(=O)N2CC(O)CC2C(=O)NC(CCCN=C(N)N)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC1=O |