N-(2-cyanoethyl)-2-diethoxyphosphinothioylsulfanyl-N-phenylacetamide structure
|
Common Name | N-(2-cyanoethyl)-2-diethoxyphosphinothioylsulfanyl-N-phenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 16231-76-8 | Molecular Weight | 372.44300 | |
| Density | 1.274g/cm3 | Boiling Point | 496.2ºC at 760 mmHg | |
| Molecular Formula | C15H21N2O3PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.9ºC | |
| Name | N-(2-cyanoethyl)-2-diethoxyphosphinothioylsulfanyl-N-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 496.2ºC at 760 mmHg |
| Molecular Formula | C15H21N2O3PS2 |
| Molecular Weight | 372.44300 |
| Flash Point | 253.9ºC |
| Exact Mass | 372.07300 |
| PSA | 129.76000 |
| LogP | 4.61458 |
| Vapour Pressure | 5.5E-10mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | OXZOAUGOOWQPDM-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SCC(=O)N(CCC#N)c1ccccc1 |
| ENT 27,312 |
| Phosphorodithioic acid,O,O-diethyl ester,S-ester with N-(2-cyanoethyl)-2-mercaptoacetanilide |
| S-(2-((2-Cyanoethyl)phenylamino)-2-oxoethyl) O,O-diethyl phosphorodithioate |