3-Pyridinecarbonitrile,1,2-dihydro-6-methyl-2-oxo-4-phenyl structure
|
Common Name | 3-Pyridinecarbonitrile,1,2-dihydro-6-methyl-2-oxo-4-phenyl | ||
|---|---|---|---|---|
| CAS Number | 16232-41-0 | Molecular Weight | 210.23100 | |
| Density | 1.22g/cm3 | Boiling Point | 411.5ºC at 760mmHg | |
| Molecular Formula | C13H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.7ºC | |
| Name | 6-methyl-2-oxo-4-phenyl-1H-pyridine-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 411.5ºC at 760mmHg |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.23100 |
| Flash Point | 202.7ºC |
| Exact Mass | 210.07900 |
| PSA | 56.91000 |
| LogP | 2.63428 |
| Vapour Pressure | 5.56E-07mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | PZXIBYLZYKFBBT-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2ccccc2)c(C#N)c(=O)[nH]1 |
| HS Code | 2933399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-methyl-2-oxo-4-phenyl-1,2-dihydropyridine-3-carbonitrile |
| 2-hydroxy-6-methyl-4-phenyl-nicotinonitrile |
| 3-CYANO-2-HYDROXY-6-METHYL-4-PHENYLPYRIDINE |
| 6-Methyl-2-oxo-4-phenyl-1,2-dihydro-3-pyridinecarbonitrile |