Acetamide,N-(7-fluoro-3-nitro-9-oxo-9H-fluoren-2-yl)- structure
|
Common Name | Acetamide,N-(7-fluoro-3-nitro-9-oxo-9H-fluoren-2-yl)- | ||
|---|---|---|---|---|
| CAS Number | 16233-04-8 | Molecular Weight | 300.24100 | |
| Density | 1.547g/cm3 | Boiling Point | 603.3ºC at 760 mmHg | |
| Molecular Formula | C15H9FN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.6ºC | |
| Name | N-(7-fluoro-3-nitro-9-oxofluoren-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.547g/cm3 |
|---|---|
| Boiling Point | 603.3ºC at 760 mmHg |
| Molecular Formula | C15H9FN2O4 |
| Molecular Weight | 300.24100 |
| Flash Point | 318.6ºC |
| Exact Mass | 300.05500 |
| PSA | 91.99000 |
| LogP | 3.49990 |
| Vapour Pressure | 1.66E-14mmHg at 25°C |
| Index of Refraction | 1.697 |
| InChIKey | KTQPRYQQIASTDS-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc2c(cc1[N+](=O)[O-])-c1ccc(F)cc1C2=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 7-Fluor-3-nitro-2-acetamino-9-oxo-fluoren |