4-(2-Morpholin-4-ylthieno[3,2-d]pyrimidin-4-yl)morpholine structure
|
Common Name | 4-(2-Morpholin-4-ylthieno[3,2-d]pyrimidin-4-yl)morpholine | ||
|---|---|---|---|---|
| CAS Number | 16234-44-9 | Molecular Weight | 306.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-Morpholin-4-ylthieno[3,2-d]pyrimidin-4-yl)morpholine |
|---|
| Molecular Formula | C14H18N4O2S |
|---|---|
| Molecular Weight | 306.39 |
| InChIKey | WZDSAEDQRWUJTE-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC(=NC3=C2SC=C3)N4CCOCC4 |
|
Name: Inhibition of full length recombinant human N-terminal His-tagged PI3K p110alpha/p85a...
Source: ChEMBL
Target: Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit alpha isoform
External Id: CHEMBL4051855
|
|
Name: Inhibition of recombinant human N-terminal FLAG-tagged mTOR (1362 to end residues) ex...
Source: ChEMBL
Target: Serine/threonine-protein kinase mTOR
External Id: CHEMBL4051856
|