2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol
Modify Date: 2026-07-19 23:48:54
![2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol Structure](https://www.chemsrc.com/extcaspic/238/162359-24-2.png)
2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol structure
|
Common Name | 2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol | ||
|---|---|---|---|---|
| CAS Number | 162359-24-2 | Molecular Weight | 307.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H33NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H33NO2 |
|---|---|
| Molecular Weight | 307.5 |
| InChIKey | VUKMITOWFKYWDF-UHFFFAOYSA-N |
| SMILES | CCCCCCCCc1cccc(CCC(N)(CO)CO)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol? |
| A: Molecular weight of 2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol is 307.5. |
| Q: What is the CAS number of 2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol? |
| A: CAS number of 2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol is 162359-24-2. |
| Q: What is the Chinese name of 162359-24-2? |
| A: Chinese name of 162359-24-2 is 162359-24-2. |
| Q: What is the SMILES notation of 2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol? |
| A: SMILES notation of 2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol is CCCCCCCCc1cccc(CCC(N)(CO)CO)c1. |
| Q: What is the InChIKey of 2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol? |
| A: InChIKey of 2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol is VUKMITOWFKYWDF-UHFFFAOYSA-N. |
| Q: What is the English name of 2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol? |
| A: The English name of 2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol is 2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol. |
| Q: What is the molecular formula of 2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol? |
| A: Molecular formula of 2-Amino-2-[2-(3-octylphenyl)ethyl]-1,3-propanediol is C19H33NO2. |