5-nitro-2-phenyl-1-benzofuran
5-nitro-2-phenyl-1-benzofuran structure
|
Common Name | 5-nitro-2-phenyl-1-benzofuran | ||
|---|---|---|---|---|
| CAS Number | 16237-97-1 | Molecular Weight | 239.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-nitro-2-phenyl-1-benzofuran |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H9NO3 |
|---|---|
| Molecular Weight | 239.22600 |
| Exact Mass | 239.05800 |
| PSA | 58.96000 |
| LogP | 4.53120 |
| InChIKey | LSIZJYOZWTXNCL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2oc(-c3ccccc3)cc2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-phenyl-5-nitrobenzofuran |
| Benzofuran,5-nitro-2-phenyl |
| 5-nitro-2-phenylbenzo[b]furan |
| 5-nitro-2-phenyl-benzofuran |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 5-nitro-2-phenyl-1-benzofuran? |
| A: Polar surface area (PSA) of 5-nitro-2-phenyl-1-benzofuran is 58.96000. |
| Q: What is the InChIKey of 5-nitro-2-phenyl-1-benzofuran? |
| A: InChIKey of 5-nitro-2-phenyl-1-benzofuran is LSIZJYOZWTXNCL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-nitro-2-phenyl-1-benzofuran? |
| A: Molecular weight of 5-nitro-2-phenyl-1-benzofuran is 239.22600. |
| Q: What is the SMILES notation of 5-nitro-2-phenyl-1-benzofuran? |
| A: SMILES notation of 5-nitro-2-phenyl-1-benzofuran is O=[N+]([O-])c1ccc2oc(-c3ccccc3)cc2c1. |
| Q: What is the LogP of 5-nitro-2-phenyl-1-benzofuran? |
| A: LogP of 5-nitro-2-phenyl-1-benzofuran is 4.53120. |
| Q: What is the CAS number of 5-nitro-2-phenyl-1-benzofuran? |
| A: CAS number of 5-nitro-2-phenyl-1-benzofuran is 16237-97-1. |
| Q: What is the English name of 5-nitro-2-phenyl-1-benzofuran? |
| A: The English name of 5-nitro-2-phenyl-1-benzofuran is 5-nitro-2-phenyl-1-benzofuran. |
| Q: What English synonyms does 5-nitro-2-phenyl-1-benzofuran have? |
| A: English synonyms of 5-nitro-2-phenyl-1-benzofuran: 2-phenyl-5-nitrobenzofuran, Benzofuran,5-nitro-2-phenyl, 5-nitro-2-phenylbenzo[b]furan, 5-nitro-2-phenyl-benzofuran. |
| Q: What is the molecular formula of 5-nitro-2-phenyl-1-benzofuran? |
| A: Molecular formula of 5-nitro-2-phenyl-1-benzofuran is C14H9NO3. |