2,2-dichloro-1,1,1,4,4,4-hexafluorobutane structure
|
Common Name | 2,2-dichloro-1,1,1,4,4,4-hexafluorobutane | ||
|---|---|---|---|---|
| CAS Number | 162462-08-0 | Molecular Weight | 234.95500 | |
| Density | 1.564g/cm3 | Boiling Point | 75-76ºC | |
| Molecular Formula | C4H2Cl2F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 8.5ºC | |
| Name | 2,2-dichloro-1,1,1,4,4,4-hexafluorobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.564g/cm3 |
|---|---|
| Boiling Point | 75-76ºC |
| Molecular Formula | C4H2Cl2F6 |
| Molecular Weight | 234.95500 |
| Flash Point | 8.5ºC |
| Exact Mass | 233.94400 |
| LogP | 3.67500 |
| Vapour Pressure | 100mmHg at 25°C |
| Index of Refraction | 1.336 |
| InChIKey | AOERTVADMVAHAA-UHFFFAOYSA-N |
| SMILES | FC(F)(F)CC(Cl)(Cl)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
|
~70%
2,2-dichloro-1,... CAS#:162462-08-0 |
| Literature: Kolomeitsev, Alexander; Shtarev, Alexander; Chabanenko, Kyrill; Savina, Tatjana; Yagupolskii, Yurii; Goerg, Michaela; Przyborowski, Jan; Lork, Enno; Roeschenthaler, Gerd-Volker Chemical Communications, 1998 , # 6 p. 705 - 706 |
|
~%
2,2-dichloro-1,... CAS#:162462-08-0 |
| Literature: Haszeldine; Nyman Journal of the Chemical Society, 1959 , p. 387,395 |
|
~%
2,2-dichloro-1,... CAS#:162462-08-0 |
| Literature: Kolomeitsev, Alexander; Goerg, Michaela; Dieckbreder, Uwe; Lork, Enno; Roeschenthaler, Gerd-Volker Phosphorus, Sulfur and Silicon and Related Elements, 1996 , vol. 109, # 1-4 p. 597 - 600 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2,2-DIACETYLINDANE |
| PC0871 |
| 2,2-Dichlor-1,1,1,4,4,4-hexafluor-butan |
| 2,2-dichloro-1,1,1,4,4,4-hexafluoro-butane |