ethyl-2-methyl-4-(2-chlorophenyl)-5-pyrimidine carboxylate structure
|
Common Name | ethyl-2-methyl-4-(2-chlorophenyl)-5-pyrimidine carboxylate | ||
|---|---|---|---|---|
| CAS Number | 162509-17-3 | Molecular Weight | 276.71800 | |
| Density | 1.236g/cm3 | Boiling Point | 400.5ºC at 760 mmHg | |
| Molecular Formula | C14H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196ºC | |
| Name | ethyl-2-methyl-4-(2-chlorophenyl)-5-pyrimidine carboxylate |
|---|
| Density | 1.236g/cm3 |
|---|---|
| Boiling Point | 400.5ºC at 760 mmHg |
| Molecular Formula | C14H13ClN2O2 |
| Molecular Weight | 276.71800 |
| Flash Point | 196ºC |
| Exact Mass | 276.06700 |
| PSA | 52.08000 |
| LogP | 3.28210 |
| Vapour Pressure | 1.26E-06mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | BLSMKNPQEOCGOZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc(C)nc1-c1ccccc1Cl |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |