Methyl 4-hydroxy-1-tosylpyrrolidine-2-carboxylate structure
|
Common Name | Methyl 4-hydroxy-1-tosylpyrrolidine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 16257-57-1 | Molecular Weight | 299.34300 | |
| Density | 1.373g/cm3 | Boiling Point | 455.3ºC at 760 mmHg | |
| Molecular Formula | C13H17NO5S | Melting Point | 97-99ºC | |
| MSDS | N/A | Flash Point | 229.1ºC | |
| Name | Methyl 4-hydroxy-1-tosylpyrrolidine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.373g/cm3 |
|---|---|
| Boiling Point | 455.3ºC at 760 mmHg |
| Melting Point | 97-99ºC |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.34300 |
| Flash Point | 229.1ºC |
| Exact Mass | 299.08300 |
| PSA | 92.29000 |
| LogP | 1.31060 |
| Vapour Pressure | 4.43E-09mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | XUMMBVXGIOJOPC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(O)CN1S(=O)(=O)c1ccc(C)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 4-hydroxy-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |