Lupichromone structure
|
Common Name | Lupichromone | ||
|---|---|---|---|---|
| CAS Number | 162616-72-0 | Molecular Weight | 314.38 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 497.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.7±22.2 °C | |
Use of LupichromoneEriosemation is a chromone derivatives that can be isolated from Flemingia philippinensis[1]. |
| Name | 5,7-Dihydroxy-6,8-bis(3-methyl-2-buten-1-yl)-4H-chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Eriosemation is a chromone derivatives that can be isolated from Flemingia philippinensis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 497.1±45.0 °C at 760 mmHg |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 |
| Flash Point | 176.7±22.2 °C |
| Exact Mass | 314.151794 |
| LogP | 4.73 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | DNZGQFQVMYCNOP-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2occc(=O)c2c1O |
| 5,7-Dihydroxy-6,8-bis(3-methyl-2-buten-1-yl)-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one, 5,7-dihydroxy-6,8-bis(3-methyl-2-buten-1-yl)- |