4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine
Modify Date: 2025-09-10 10:45:12
4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine structure
|
Common Name | 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine | ||
|---|---|---|---|---|
| CAS Number | 1628015-18-8 | Molecular Weight | 315.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12F3NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12F3NO2S |
|---|---|
| Molecular Weight | 315.31 |
| InChIKey | CUSDIJRQJUNPIC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(N)cc2C(F)(F)F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine? |
| A: The English name of 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine is 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine. |
| Q: What is the molecular formula of 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine? |
| A: Molecular formula of 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine is C14H12F3NO2S. |
| Q: What is the CAS number of 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine? |
| A: CAS number of 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine is 1628015-18-8. |
| Q: What is the SMILES notation of 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine? |
| A: SMILES notation of 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine is CS(=O)(=O)c1ccc(-c2ccc(N)cc2C(F)(F)F)cc1. |
| Q: What is the molecular weight of 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine? |
| A: Molecular weight of 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine is 315.31. |
| Q: What is the InChIKey of 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine? |
| A: InChIKey of 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine is CUSDIJRQJUNPIC-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1628015-18-8? |
| A: Chinese name of 1628015-18-8 is 1628015-18-8. |