3-Nitro-4-(1H-pyrazol-1-yl)benzoic acid structure
|
Common Name | 3-Nitro-4-(1H-pyrazol-1-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 162848-25-1 | Molecular Weight | 233.180 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 436.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H7N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.6±27.3 °C | |
| Name | 3-Nitro-4-(1-pyrazolyl)benzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 436.2±40.0 °C at 760 mmHg |
| Molecular Formula | C10H7N3O4 |
| Molecular Weight | 233.180 |
| Flash Point | 217.6±27.3 °C |
| Exact Mass | 233.043655 |
| PSA | 100.94000 |
| LogP | 2.26 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.687 |
| InChIKey | YPKLOOQBMQJXKS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-n2cccn2)c([N+](=O)[O-])c1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Nitro-4-(1H-pyrazol-1-yl)benzoic acid |
| 3-nitro-4-pyrazol-1-ylbenzoic acid |
| Benzoic acid, 3-nitro-4-(1H-pyrazol-1-yl)- |