4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide
Modify Date: 2026-07-16 17:16:54
4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide structure
|
Common Name | 4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide | ||
|---|---|---|---|---|
| CAS Number | 1628860-82-1 | Molecular Weight | 238.59 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6ClF3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H6ClF3N2O |
|---|---|
| Molecular Weight | 238.59 |
| InChIKey | OKARUWMOWLVBHX-UHFFFAOYSA-N |
| SMILES | NC(=NO)c1ccc(Cl)cc1C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1628860-82-1? |
| A: Chinese name of 1628860-82-1 is 1628860-82-1. |
| Q: What is the SMILES notation of 4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide? |
| A: SMILES notation of 4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide is NC(=NO)c1ccc(Cl)cc1C(F)(F)F. |
| Q: What is the molecular formula of 4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide? |
| A: Molecular formula of 4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide is C8H6ClF3N2O. |
| Q: What is the English name of 4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide? |
| A: The English name of 4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide is 4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide. |
| Q: What is the InChIKey of 4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide? |
| A: InChIKey of 4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide is OKARUWMOWLVBHX-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide? |
| A: CAS number of 4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide is 1628860-82-1. |
| Q: What is the molecular weight of 4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide? |
| A: Molecular weight of 4-Chloro-N inverted exclamation mark-hydroxy-2-(trifluoromethyl)benzimidamide is 238.59. |