Benzenecarbothioamide,N-(2-chlorophenyl)-4-fluoro structure
|
Common Name | Benzenecarbothioamide,N-(2-chlorophenyl)-4-fluoro | ||
|---|---|---|---|---|
| CAS Number | 1629-22-7 | Molecular Weight | 265.73400 | |
| Density | 1.381g/cm3 | Boiling Point | 349.5ºC at 760mmHg | |
| Molecular Formula | C13H9ClFNS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.2ºC | |
| Name | N-(2-chlorophenyl)-4-fluorobenzenecarbothioamide |
|---|
| Density | 1.381g/cm3 |
|---|---|
| Boiling Point | 349.5ºC at 760mmHg |
| Molecular Formula | C13H9ClFNS |
| Molecular Weight | 265.73400 |
| Flash Point | 165.2ºC |
| Exact Mass | 265.01300 |
| PSA | 44.12000 |
| LogP | 4.33970 |
| Vapour Pressure | 4.68E-05mmHg at 25°C |
| Index of Refraction | 1.683 |
| InChIKey | FUXAPUBLPSKXPC-UHFFFAOYSA-N |
| SMILES | Fc1ccc(C(=S)Nc2ccccc2Cl)cc1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|