(S)-3-(3-METHOXYPHENYL)PIPERIDINE structure
|
Common Name | (S)-3-(3-METHOXYPHENYL)PIPERIDINE | ||
|---|---|---|---|---|
| CAS Number | 162919-37-1 | Molecular Weight | 272.29600 | |
| Density | 1.26g/cm3 | Boiling Point | 474.3ºC at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.3ºC | |
| Name | (2S)-2-hydroxy-3-(4-phenylmethoxyphenyl)propanoic acid |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 474.3ºC at 760 mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29600 |
| Flash Point | 177.3ºC |
| Exact Mass | 272.10500 |
| PSA | 66.76000 |
| LogP | 2.25360 |
| Vapour Pressure | 8.4E-10mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | RADJEIZOJZINJB-HNNXBMFYSA-N |
| SMILES | O=C(O)C(O)Cc1ccc(OCc2ccccc2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |